C11H12N4O2S — CID 115460822
2-[2-[(1-methyltetrazol-5-yl)sulfanylmethyl]phenyl]acetic acid (PubChem CID 115460822) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-[2-[(1-methyltetrazol-5-yl)sulfanylmethyl]phenyl]acetic acid.
| Compound Name | 2-[2-[(1-methyltetrazol-5-yl)sulfanylmethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 115460822 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-[2-[(1-methyltetrazol-5-yl)sulfanylmethyl]phenyl]acetic acid |
| SMILES | Cn1nnnc1SCc1ccccc1CC(=O)O |
| InChI | InChI=1S/C11H12N4O2S/c1-15-11(12-13-14-15)18-7-9-5-3-2-4-8(9)6-10(16)17/h2-5H,6-7H2,1H3,(H,16,17) |
| InChIKey | JQSDMSOOXIZIOE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |