About 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol
5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol (PubChem CID 157111853) has the molecular formula C12H18N4OS
and a molecular weight of 266.37 g/mol. Its IUPAC name is 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol.
Molecular Properties
| Compound Name | 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol |
| PubChem CID | 157111853 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol |
| SMILES | CC(O)c1ccccc1.CCSc1nnnn1C |
| InChI | InChI=1S/C8H10O.C4H8N4S/c1-7(9)8-5-3-2-4-6-8;1-3-9-4-5-6-7-8(4)2/h2-7,9H,1H3;3H2,1-2H3 |
| InChIKey | AGYGLBLUUGVBBJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol?
The IUPAC name of 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol (CID 157111853) is 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol.
What is the SMILES notation for 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol?
The canonical SMILES for 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol is CC(O)c1ccccc1.CCSc1nnnn1C.
What is the InChIKey of 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol?
The InChIKey is AGYGLBLUUGVBBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C4H8N4S/c1-7(9)8-5-3-2-4-6-8;1-3-9-4-5-6-7-8(4)2/h2-7,9H,1H3;3H2,1-2H3.
What are the key properties of 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol?
5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol has a molecular weight of 266.37 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfanyl-1-methyltetrazole;1-phenylethanol is sourced from PubChem (CID 157111853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).