C15H15N5OS2 — CID 9231123
2-(1-methyltetrazol-5-yl)sulfanyl-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 9231123) has the molecular formula C15H15N5OS2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 9231123 |
| Molecular Formula | C15H15N5OS2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | Cn1nnnc1SCC(=O)N[C@@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C15H15N5OS2/c1-20-15(17-18-19-20)23-10-13(21)16-14(12-8-5-9-22-12)11-6-3-2-4-7-11/h2-9,14H,10H2,1H3,(H,16,21)/t14-/m0/s1 |
| InChIKey | NBHCTFSPIIZFRM-AWEZNQCLSA-N |
| XLogP | 2.27 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |