C21H19N3OS2 — CID 40673833
2-(1-methylbenzimidazol-2-yl)sulfanyl-N-[(R)-phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 40673833) has the molecular formula C21H19N3OS2 and a molecular weight of 393.54 g/mol. Its IUPAC name is 2-(1-methylbenzimidazol-2-yl)sulfanyl-N-[(R)-phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(1-methylbenzimidazol-2-yl)sulfanyl-N-[(R)-phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 40673833 |
| Molecular Formula | C21H19N3OS2 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-(1-methylbenzimidazol-2-yl)sulfanyl-N-[(R)-phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | Cn1c(SCC(=O)N[C@H](c2ccccc2)c2cccs2)nc2ccccc21 |
| InChI | InChI=1S/C21H19N3OS2/c1-24-17-11-6-5-10-16(17)22-21(24)27-14-19(25)23-20(18-12-7-13-26-18)15-8-3-2-4-9-15/h2-13,20H,14H2,1H3,(H,23,25)/t20-/m1/s1 |
| InChIKey | WZFMZTLENILRSA-HXUWFJFHSA-N |
| XLogP | 4.63 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |