C15H21N5OS — CID 40751028
(2R)-2-(1-methyltetrazol-5-yl)sulfanyl-N-[(1R)-1-phenylbutyl]propanamide (PubChem CID 40751028) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is (2R)-2-(1-methyltetrazol-5-yl)sulfanyl-N-[(1R)-1-phenylbutyl]propanamide.
| Compound Name | (2R)-2-(1-methyltetrazol-5-yl)sulfanyl-N-[(1R)-1-phenylbutyl]propanamide |
|---|---|
| PubChem CID | 40751028 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (2R)-2-(1-methyltetrazol-5-yl)sulfanyl-N-[(1R)-1-phenylbutyl]propanamide |
| SMILES | CCC[C@@H](NC(=O)[C@@H](C)Sc1nnnn1C)c1ccccc1 |
| InChI | InChI=1S/C15H21N5OS/c1-4-8-13(12-9-6-5-7-10-12)16-14(21)11(2)22-15-17-18-19-20(15)3/h5-7,9-11,13H,4,8H2,1-3H3,(H,16,21)/t11-,13-/m1/s1 |
| InChIKey | UJVPMIOHLQDVQQ-DGCLKSJQSA-N |
| XLogP | 2.35 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |