C6H10N4O2S — CID 43538122
2-methyl-3-(1-methyltetrazol-5-yl)sulfanylpropanoic acid (PubChem CID 43538122) has the molecular formula C6H10N4O2S and a molecular weight of 202.24 g/mol. Its IUPAC name is 2-methyl-3-(1-methyltetrazol-5-yl)sulfanylpropanoic acid.
| Compound Name | 2-methyl-3-(1-methyltetrazol-5-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43538122 |
| Molecular Formula | C6H10N4O2S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 2-methyl-3-(1-methyltetrazol-5-yl)sulfanylpropanoic acid |
| SMILES | CC(CSc1nnnn1C)C(=O)O |
| InChI | InChI=1S/C6H10N4O2S/c1-4(5(11)12)3-13-6-7-8-9-10(6)2/h4H,3H2,1-2H3,(H,11,12) |
| InChIKey | JXSYPZRZVDCNLG-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |