C10H12N6OS — CID 43376992
3-amino-4-[(1-methyltetrazol-5-yl)sulfanylmethyl]benzamide (PubChem CID 43376992) has the molecular formula C10H12N6OS and a molecular weight of 264.31 g/mol. Its IUPAC name is 3-amino-4-[(1-methyltetrazol-5-yl)sulfanylmethyl]benzamide.
| Compound Name | 3-amino-4-[(1-methyltetrazol-5-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 43376992 |
| Molecular Formula | C10H12N6OS |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 3-amino-4-[(1-methyltetrazol-5-yl)sulfanylmethyl]benzamide |
| SMILES | Cn1nnnc1SCc1ccc(C(N)=O)cc1N |
| InChI | InChI=1S/C10H12N6OS/c1-16-10(13-14-15-16)18-5-7-3-2-6(9(12)17)4-8(7)11/h2-4H,5,11H2,1H3,(H2,12,17) |
| InChIKey | HQAAHZAMFYOQDO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|