C12H14FN5OS — CID 63539433
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-5-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 63539433) has the molecular formula C12H14FN5OS and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-5-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-5-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 63539433 |
| Molecular Formula | C12H14FN5OS |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-5-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | Cc1nnc(SCc2ccc(F)cc2/C(N)=N/O)n1C |
| InChI | InChI=1S/C12H14FN5OS/c1-7-15-16-12(18(7)2)20-6-8-3-4-9(13)5-10(8)11(14)17-19/h3-5,19H,6H2,1-2H3,(H2,14,17) |
| InChIKey | MUERIWHFBSHFHO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|