C12H15N5OS — CID 107931097
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-5-methylbenzenecarboximidamide (PubChem CID 107931097) has the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-5-methylbenzenecarboximidamide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-5-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107931097 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-N'-hydroxy-5-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(Sc2nnc(C)n2C)c(/C(N)=N/O)c1 |
| InChI | InChI=1S/C12H15N5OS/c1-7-4-5-10(9(6-7)11(13)16-18)19-12-15-14-8(2)17(12)3/h4-6,18H,1-3H3,(H2,13,16) |
| InChIKey | CHMZZIAVBDJOQG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|