C14H18ClN5S — CID 78938021
(1S)-1-[3-chloro-4-(1-cyclopentyltetrazol-5-yl)sulfanylphenyl]ethanamine (PubChem CID 78938021) has the molecular formula C14H18ClN5S and a molecular weight of 323.85 g/mol. Its IUPAC name is (1S)-1-[3-chloro-4-(1-cyclopentyltetrazol-5-yl)sulfanylphenyl]ethanamine.
| Compound Name | (1S)-1-[3-chloro-4-(1-cyclopentyltetrazol-5-yl)sulfanylphenyl]ethanamine |
|---|---|
| PubChem CID | 78938021 |
| Molecular Formula | C14H18ClN5S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | (1S)-1-[3-chloro-4-(1-cyclopentyltetrazol-5-yl)sulfanylphenyl]ethanamine |
| SMILES | C[C@H](N)c1ccc(Sc2nnnn2C2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClN5S/c1-9(16)10-6-7-13(12(15)8-10)21-14-17-18-19-20(14)11-4-2-3-5-11/h6-9,11H,2-5,16H2,1H3/t9-/m0/s1 |
| InChIKey | GMMAJDRLBJLBOA-VIFPVBQESA-N |
| XLogP | 3.61 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |