C11H13N5OS — CID 114057132
(1S)-1-[2-(1-cyclopropyltetrazol-5-yl)sulfanyl-3-pyridinyl]ethanol (PubChem CID 114057132) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is (1S)-1-[2-(1-cyclopropyltetrazol-5-yl)sulfanyl-3-pyridinyl]ethanol.
| Compound Name | (1S)-1-[2-(1-cyclopropyltetrazol-5-yl)sulfanyl-3-pyridinyl]ethanol |
|---|---|
| PubChem CID | 114057132 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (1S)-1-[2-(1-cyclopropyltetrazol-5-yl)sulfanyl-3-pyridinyl]ethanol |
| SMILES | C[C@H](O)c1cccnc1Sc1nnnn1C1CC1 |
| InChI | InChI=1S/C11H13N5OS/c1-7(17)9-3-2-6-12-10(9)18-11-13-14-15-16(11)8-4-5-8/h2-3,6-8,17H,4-5H2,1H3/t7-/m0/s1 |
| InChIKey | YEMFUXVKVHHPRA-ZETCQYMHSA-N |
| XLogP | 1.61 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |