C12H13ClN4S — CID 47124356
5-[1-(2-chlorophenyl)ethylsulfanyl]-1-cyclopropyltetrazole (PubChem CID 47124356) has the molecular formula C12H13ClN4S and a molecular weight of 280.78 g/mol. Its IUPAC name is 5-[1-(2-chlorophenyl)ethylsulfanyl]-1-cyclopropyltetrazole.
| Compound Name | 5-[1-(2-chlorophenyl)ethylsulfanyl]-1-cyclopropyltetrazole |
|---|---|
| PubChem CID | 47124356 |
| Molecular Formula | C12H13ClN4S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 5-[1-(2-chlorophenyl)ethylsulfanyl]-1-cyclopropyltetrazole |
| SMILES | CC(Sc1nnnn1C1CC1)c1ccccc1Cl |
| InChI | InChI=1S/C12H13ClN4S/c1-8(10-4-2-3-5-11(10)13)18-12-14-15-16-17(12)9-6-7-9/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | GFNBPIRDYDNHRU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |