C13H13ClN4O2S — CID 87044222
(3-chlorophenyl) 2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoate (PubChem CID 87044222) has the molecular formula C13H13ClN4O2S and a molecular weight of 324.79 g/mol. Its IUPAC name is (3-chlorophenyl) 2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoate.
| Compound Name | (3-chlorophenyl) 2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 87044222 |
| Molecular Formula | C13H13ClN4O2S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (3-chlorophenyl) 2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoate |
| SMILES | CC(Sc1nnnn1C1CC1)C(=O)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H13ClN4O2S/c1-8(12(19)20-11-4-2-3-9(14)7-11)21-13-15-16-17-18(13)10-5-6-10/h2-4,7-8,10H,5-6H2,1H3 |
| InChIKey | INGGLEOMIDEMGH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|