C18H24N6O3S — CID 55974525
[4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoate (PubChem CID 55974525) has the molecular formula C18H24N6O3S and a molecular weight of 404.50 g/mol. Its IUPAC name is [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoate.
| Compound Name | [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 55974525 |
| Molecular Formula | C18H24N6O3S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 2-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoate |
| SMILES | CC(C)NC(=O)N(C)c1ccc(OC(=O)C(C)Sc2nnnn2C2CC2)cc1 |
| InChI | InChI=1S/C18H24N6O3S/c1-11(2)19-17(26)23(4)13-7-9-15(10-8-13)27-16(25)12(3)28-18-20-21-22-24(18)14-5-6-14/h7-12,14H,5-6H2,1-4H3,(H,19,26) |
| InChIKey | ZPCCYVDTNJHNPF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|