C10H12FN7S — CID 80883686
4-(1-cyclopentyltetrazol-5-yl)sulfanyl-5-fluoropyrimidin-2-amine (PubChem CID 80883686) has the molecular formula C10H12FN7S and a molecular weight of 281.32 g/mol. Its IUPAC name is 4-(1-cyclopentyltetrazol-5-yl)sulfanyl-5-fluoropyrimidin-2-amine.
| Compound Name | 4-(1-cyclopentyltetrazol-5-yl)sulfanyl-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 80883686 |
| Molecular Formula | C10H12FN7S |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-(1-cyclopentyltetrazol-5-yl)sulfanyl-5-fluoropyrimidin-2-amine |
| SMILES | Nc1ncc(F)c(Sc2nnnn2C2CCCC2)n1 |
| InChI | InChI=1S/C10H12FN7S/c11-7-5-13-9(12)14-8(7)19-10-15-16-17-18(10)6-3-1-2-4-6/h5-6H,1-4H2,(H2,12,13,14) |
| InChIKey | IGHFVQCQDBULPR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |