C8H8F3N7S — CID 102721387
[6-(1-methyltetrazol-5-yl)sulfanyl-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 102721387) has the molecular formula C8H8F3N7S and a molecular weight of 291.26 g/mol. Its IUPAC name is [6-(1-methyltetrazol-5-yl)sulfanyl-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-(1-methyltetrazol-5-yl)sulfanyl-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102721387 |
| Molecular Formula | C8H8F3N7S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | [6-(1-methyltetrazol-5-yl)sulfanyl-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | Cn1nnnc1Sc1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C8H8F3N7S/c1-18-7(15-16-17-18)19-6-3-4(8(9,10)11)2-5(13-6)14-12/h2-3H,12H2,1H3,(H,13,14) |
| InChIKey | BAGXMFHVMMCOFO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|