C9H9F3N6S — CID 102721368
[6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 102721368) has the molecular formula C9H9F3N6S and a molecular weight of 290.27 g/mol. Its IUPAC name is [6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102721368 |
| Molecular Formula | C9H9F3N6S |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | [6-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | Cn1cnnc1Sc1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C9H9F3N6S/c1-18-4-14-17-8(18)19-7-3-5(9(10,11)12)2-6(15-7)16-13/h2-4H,13H2,1H3,(H,15,16) |
| InChIKey | UNBXGJULXDNBTF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|