C10H11F3N6S — CID 102720216
N-ethyl-6-(1-methyltetrazol-5-yl)sulfanyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102720216) has the molecular formula C10H11F3N6S and a molecular weight of 304.30 g/mol. Its IUPAC name is N-ethyl-6-(1-methyltetrazol-5-yl)sulfanyl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-ethyl-6-(1-methyltetrazol-5-yl)sulfanyl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102720216 |
| Molecular Formula | C10H11F3N6S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-ethyl-6-(1-methyltetrazol-5-yl)sulfanyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCNc1cc(C(F)(F)F)cc(Sc2nnnn2C)n1 |
| InChI | InChI=1S/C10H11F3N6S/c1-3-14-7-4-6(10(11,12)13)5-8(15-7)20-9-16-17-18-19(9)2/h4-5H,3H2,1-2H3,(H,14,15) |
| InChIKey | RLPRABRZMPMYCS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |