C14H13F3N2S — CID 102720209
N-ethyl-6-phenylsulfanyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102720209) has the molecular formula C14H13F3N2S and a molecular weight of 298.33 g/mol. Its IUPAC name is N-ethyl-6-phenylsulfanyl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-ethyl-6-phenylsulfanyl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102720209 |
| Molecular Formula | C14H13F3N2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N-ethyl-6-phenylsulfanyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCNc1cc(C(F)(F)F)cc(Sc2ccccc2)n1 |
| InChI | InChI=1S/C14H13F3N2S/c1-2-18-12-8-10(14(15,16)17)9-13(19-12)20-11-6-4-3-5-7-11/h3-9H,2H2,1H3,(H,18,19) |
| InChIKey | FPXMLUOLYICJHP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |