C12H16F3N3S — CID 102721404
[6-cyclohexylsulfanyl-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 102721404) has the molecular formula C12H16F3N3S and a molecular weight of 291.34 g/mol. Its IUPAC name is [6-cyclohexylsulfanyl-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-cyclohexylsulfanyl-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102721404 |
| Molecular Formula | C12H16F3N3S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | [6-cyclohexylsulfanyl-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1cc(C(F)(F)F)cc(SC2CCCCC2)n1 |
| InChI | InChI=1S/C12H16F3N3S/c13-12(14,15)8-6-10(18-16)17-11(7-8)19-9-4-2-1-3-5-9/h6-7,9H,1-5,16H2,(H,17,18) |
| InChIKey | DBPFJZQEDPWUMH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|