C9H7F3N4OS — CID 106928799
[6-(1,3-oxazol-2-ylsulfanyl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 106928799) has the molecular formula C9H7F3N4OS and a molecular weight of 276.24 g/mol. Its IUPAC name is [6-(1,3-oxazol-2-ylsulfanyl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-(1,3-oxazol-2-ylsulfanyl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 106928799 |
| Molecular Formula | C9H7F3N4OS |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | [6-(1,3-oxazol-2-ylsulfanyl)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1cc(C(F)(F)F)cc(Sc2ncco2)n1 |
| InChI | InChI=1S/C9H7F3N4OS/c10-9(11,12)5-3-6(16-13)15-7(4-5)18-8-14-1-2-17-8/h1-4H,13H2,(H,15,16) |
| InChIKey | ZWHJGIGIDVISTI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|