C11H11F3N4O — CID 102721141
N-(furan-3-ylmethyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102721141) has the molecular formula C11H11F3N4O and a molecular weight of 272.23 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(furan-3-ylmethyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102721141 |
| Molecular Formula | C11H11F3N4O |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N-(furan-3-ylmethyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | NNc1cc(C(F)(F)F)cc(NCc2ccoc2)n1 |
| InChI | InChI=1S/C11H11F3N4O/c12-11(13,14)8-3-9(17-10(4-8)18-15)16-5-7-1-2-19-6-7/h1-4,6H,5,15H2,(H2,16,17,18) |
| InChIKey | QGFJEJZQLCUWFD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|