C12H19F3N4 — CID 102720794
N-(2,3-dimethylbutyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102720794) has the molecular formula C12H19F3N4 and a molecular weight of 276.31 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(2,3-dimethylbutyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102720794 |
| Molecular Formula | C12H19F3N4 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-(2,3-dimethylbutyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)C(C)CNc1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C12H19F3N4/c1-7(2)8(3)6-17-10-4-9(12(13,14)15)5-11(18-10)19-16/h4-5,7-8H,6,16H2,1-3H3,(H2,17,18,19) |
| InChIKey | CBNUZOMQIRLEBU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|