C13H21F3N4 — CID 102720760
6-hydrazinyl-N-(5-methylhexan-2-yl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102720760) has the molecular formula C13H21F3N4 and a molecular weight of 290.33 g/mol. Its IUPAC name is 6-hydrazinyl-N-(5-methylhexan-2-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-hydrazinyl-N-(5-methylhexan-2-yl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102720760 |
| Molecular Formula | C13H21F3N4 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 6-hydrazinyl-N-(5-methylhexan-2-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)CCC(C)Nc1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C13H21F3N4/c1-8(2)4-5-9(3)18-11-6-10(13(14,15)16)7-12(19-11)20-17/h6-9H,4-5,17H2,1-3H3,(H2,18,19,20) |
| InChIKey | BGNFPDHCQGEQIV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|