C11H17F3N4 — CID 102720431
6-hydrazinyl-N-methyl-N-(2-methylpropyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102720431) has the molecular formula C11H17F3N4 and a molecular weight of 262.28 g/mol. Its IUPAC name is 6-hydrazinyl-N-methyl-N-(2-methylpropyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-hydrazinyl-N-methyl-N-(2-methylpropyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102720431 |
| Molecular Formula | C11H17F3N4 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 6-hydrazinyl-N-methyl-N-(2-methylpropyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)CN(C)c1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C11H17F3N4/c1-7(2)6-18(3)10-5-8(11(12,13)14)4-9(16-10)17-15/h4-5,7H,6,15H2,1-3H3,(H,16,17) |
| InChIKey | UTRRLIQJGGIGKT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|