C11H16F3N3O — CID 102721220
[6-(3-methylbutoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 102721220) has the molecular formula C11H16F3N3O and a molecular weight of 263.26 g/mol. Its IUPAC name is [6-(3-methylbutoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-(3-methylbutoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102721220 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [6-(3-methylbutoxy)-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | CC(C)CCOc1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C11H16F3N3O/c1-7(2)3-4-18-10-6-8(11(12,13)14)5-9(16-10)17-15/h5-7H,3-4,15H2,1-2H3,(H,16,17) |
| InChIKey | BOXDBQBDAIQZPO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|