C12H17F3N2O2 — CID 102719988
N-methyl-6-(2-propoxyethoxy)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102719988) has the molecular formula C12H17F3N2O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is N-methyl-6-(2-propoxyethoxy)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-methyl-6-(2-propoxyethoxy)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102719988 |
| Molecular Formula | C12H17F3N2O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-methyl-6-(2-propoxyethoxy)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCCOCCOc1cc(C(F)(F)F)cc(NC)n1 |
| InChI | InChI=1S/C12H17F3N2O2/c1-3-4-18-5-6-19-11-8-9(12(13,14)15)7-10(16-2)17-11/h7-8H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | HFPBKHCARDCTEG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|