C15H19F3N2O — CID 102719626
N-methyl-6-[(6-methylcyclohex-3-en-1-yl)methoxy]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102719626) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is N-methyl-6-[(6-methylcyclohex-3-en-1-yl)methoxy]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-methyl-6-[(6-methylcyclohex-3-en-1-yl)methoxy]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102719626 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-methyl-6-[(6-methylcyclohex-3-en-1-yl)methoxy]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CNc1cc(C(F)(F)F)cc(OCC2CC=CCC2C)n1 |
| InChI | InChI=1S/C15H19F3N2O/c1-10-5-3-4-6-11(10)9-21-14-8-12(15(16,17)18)7-13(19-2)20-14/h3-4,7-8,10-11H,5-6,9H2,1-2H3,(H,19,20) |
| InChIKey | RPGQVAHABIDXCP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|