C12H16ClF3N2 — CID 102715487
6-chloro-N-methyl-N-(2-methylbutyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102715487) has the molecular formula C12H16ClF3N2 and a molecular weight of 280.72 g/mol. Its IUPAC name is 6-chloro-N-methyl-N-(2-methylbutyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-methyl-N-(2-methylbutyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102715487 |
| Molecular Formula | C12H16ClF3N2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 6-chloro-N-methyl-N-(2-methylbutyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCC(C)CN(C)c1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C12H16ClF3N2/c1-4-8(2)7-18(3)11-6-9(12(14,15)16)5-10(13)17-11/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | FEFGXXNPBSFANW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|