C13H17ClF3N3O — CID 102716156
2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-N-(2-methylpropyl)acetamide (PubChem CID 102716156) has the molecular formula C13H17ClF3N3O and a molecular weight of 323.75 g/mol. Its IUPAC name is 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 102716156 |
| Molecular Formula | C13H17ClF3N3O |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)CN(C)c1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C13H17ClF3N3O/c1-8(2)6-18-12(21)7-20(3)11-5-9(13(15,16)17)4-10(14)19-11/h4-5,8H,6-7H2,1-3H3,(H,18,21) |
| InChIKey | MVYLRODTXWSPKH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|