C12H19ClN4OS — CID 113409410
2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)-methylamino]-N-(2-methylpropyl)acetamide (PubChem CID 113409410) has the molecular formula C12H19ClN4OS and a molecular weight of 302.83 g/mol. Its IUPAC name is 2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)-methylamino]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)-methylamino]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 113409410 |
| Molecular Formula | C12H19ClN4OS |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)-methylamino]-N-(2-methylpropyl)acetamide |
| SMILES | CSc1nc(Cl)cc(N(C)CC(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C12H19ClN4OS/c1-8(2)6-14-11(18)7-17(3)10-5-9(13)15-12(16-10)19-4/h5,8H,6-7H2,1-4H3,(H,14,18) |
| InChIKey | XHMPFHNYRPGLCQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |