C9H12ClN3O2S — CID 3321692
methyl 2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)-methylamino]acetate (PubChem CID 3321692) has the molecular formula C9H12ClN3O2S and a molecular weight of 261.73 g/mol. Its IUPAC name is methyl 2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)-methylamino]acetate.
| Compound Name | methyl 2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)-methylamino]acetate |
|---|---|
| PubChem CID | 3321692 |
| Molecular Formula | C9H12ClN3O2S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | methyl 2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)-methylamino]acetate |
| SMILES | COC(=O)CN(C)c1cc(Cl)nc(SC)n1 |
| InChI | InChI=1S/C9H12ClN3O2S/c1-13(5-8(14)15-2)7-4-6(10)11-9(12-7)16-3/h4H,5H2,1-3H3 |
| InChIKey | IETFHGVYLDYHJX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |