C12H19ClN4O — CID 104513833
2-[(6-chloropyridazin-3-yl)methyl-methylamino]-N-(2-methylpropyl)acetamide (PubChem CID 104513833) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-[(6-chloropyridazin-3-yl)methyl-methylamino]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[(6-chloropyridazin-3-yl)methyl-methylamino]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 104513833 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[(6-chloropyridazin-3-yl)methyl-methylamino]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)CN(C)Cc1ccc(Cl)nn1 |
| InChI | InChI=1S/C12H19ClN4O/c1-9(2)6-14-12(18)8-17(3)7-10-4-5-11(13)16-15-10/h4-5,9H,6-8H2,1-3H3,(H,14,18) |
| InChIKey | LBHNFEOXEXMBMV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |