C12H9Cl2F3N2S — CID 102715602
6-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102715602) has the molecular formula C12H9Cl2F3N2S and a molecular weight of 341.19 g/mol. Its IUPAC name is 6-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102715602 |
| Molecular Formula | C12H9Cl2F3N2S |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 6-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CN(Cc1ccc(Cl)s1)c1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C12H9Cl2F3N2S/c1-19(6-8-2-3-10(14)20-8)11-5-7(12(15,16)17)4-9(13)18-11/h2-5H,6H2,1H3 |
| InChIKey | LRBUIKMKVLTTBH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|