C13H9ClF3N3S — CID 78965959
2-[(5-chlorothiophen-2-yl)methyl-methylamino]-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 78965959) has the molecular formula C13H9ClF3N3S and a molecular weight of 331.75 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 78965959 |
| Molecular Formula | C13H9ClF3N3S |
| Molecular Weight | 331.75 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CN(Cc1ccc(Cl)s1)c1nc(C(F)(F)F)ccc1C#N |
| InChI | InChI=1S/C13H9ClF3N3S/c1-20(7-9-3-5-11(14)21-9)12-8(6-18)2-4-10(19-12)13(15,16)17/h2-5H,7H2,1H3 |
| InChIKey | OJUVPMDGIOHBIT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.75 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |