C13H15F3N4 — CID 106618416
2-[methyl(pyrrolidin-2-ylmethyl)amino]-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 106618416) has the molecular formula C13H15F3N4 and a molecular weight of 284.28 g/mol. Its IUPAC name is 2-[methyl(pyrrolidin-2-ylmethyl)amino]-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-[methyl(pyrrolidin-2-ylmethyl)amino]-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 106618416 |
| Molecular Formula | C13H15F3N4 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-[methyl(pyrrolidin-2-ylmethyl)amino]-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CN(CC1CCCN1)c1nc(C(F)(F)F)ccc1C#N |
| InChI | InChI=1S/C13H15F3N4/c1-20(8-10-3-2-6-18-10)12-9(7-17)4-5-11(19-12)13(14,15)16/h4-5,10,18H,2-3,6,8H2,1H3 |
| InChIKey | RVEATIDKEKYDPN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |