C14H16F3N3O — CID 79875315
2-[cyclopentyl(2-hydroxyethyl)amino]-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 79875315) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 2-[cyclopentyl(2-hydroxyethyl)amino]-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-[cyclopentyl(2-hydroxyethyl)amino]-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 79875315 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[cyclopentyl(2-hydroxyethyl)amino]-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)nc1N(CCO)C1CCCC1 |
| InChI | InChI=1S/C14H16F3N3O/c15-14(16,17)12-6-5-10(9-18)13(19-12)20(7-8-21)11-3-1-2-4-11/h5-6,11,21H,1-4,7-8H2 |
| InChIKey | KJNPEODRFQHYLQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |