C12H16N4 — CID 106618513
3-[methyl(pyrrolidin-2-ylmethyl)amino]pyridine-2-carbonitrile (PubChem CID 106618513) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 3-[methyl(pyrrolidin-2-ylmethyl)amino]pyridine-2-carbonitrile.
| Compound Name | 3-[methyl(pyrrolidin-2-ylmethyl)amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 106618513 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3-[methyl(pyrrolidin-2-ylmethyl)amino]pyridine-2-carbonitrile |
| SMILES | CN(CC1CCCN1)c1cccnc1C#N |
| InChI | InChI=1S/C12H16N4/c1-16(9-10-4-2-6-14-10)12-5-3-7-15-11(12)8-13/h3,5,7,10,14H,2,4,6,9H2,1H3 |
| InChIKey | RQYGLSLJACSBIL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |