C13H18N4O2S — CID 106608008
2-cyano-N-ethyl-N-(pyrrolidin-2-ylmethyl)pyridine-3-sulfonamide (PubChem CID 106608008) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-cyano-N-ethyl-N-(pyrrolidin-2-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 2-cyano-N-ethyl-N-(pyrrolidin-2-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106608008 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-cyano-N-ethyl-N-(pyrrolidin-2-ylmethyl)pyridine-3-sulfonamide |
| SMILES | CCN(CC1CCCN1)S(=O)(=O)c1cccnc1C#N |
| InChI | InChI=1S/C13H18N4O2S/c1-2-17(10-11-5-3-7-15-11)20(18,19)13-6-4-8-16-12(13)9-14/h4,6,8,11,15H,2-3,5,7,10H2,1H3 |
| InChIKey | QASWCGQGYQMWNP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |