C11H16ClN3 — CID 106618690
3-chloro-N-methyl-N-(pyrrolidin-2-ylmethyl)pyridin-2-amine (PubChem CID 106618690) has the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-(pyrrolidin-2-ylmethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-methyl-N-(pyrrolidin-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106618690 |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-chloro-N-methyl-N-(pyrrolidin-2-ylmethyl)pyridin-2-amine |
| SMILES | CN(CC1CCCN1)c1ncccc1Cl |
| InChI | InChI=1S/C11H16ClN3/c1-15(8-9-4-2-6-13-9)11-10(12)5-3-7-14-11/h3,5,7,9,13H,2,4,6,8H2,1H3 |
| InChIKey | GKONDRUIBAWBHI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |