C11H17ClN4 — CID 97164149
2-chloro-N-methyl-N-[[(2S)-piperidin-2-yl]methyl]pyrimidin-4-amine (PubChem CID 97164149) has the molecular formula C11H17ClN4 and a molecular weight of 240.74 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-[[(2S)-piperidin-2-yl]methyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-methyl-N-[[(2S)-piperidin-2-yl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 97164149 |
| Molecular Formula | C11H17ClN4 |
| Molecular Weight | 240.74 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-chloro-N-methyl-N-[[(2S)-piperidin-2-yl]methyl]pyrimidin-4-amine |
| SMILES | CN(C[C@@H]1CCCCN1)c1ccnc(Cl)n1 |
| InChI | InChI=1S/C11H17ClN4/c1-16(8-9-4-2-3-6-13-9)10-5-7-14-11(12)15-10/h5,7,9,13H,2-4,6,8H2,1H3/t9-/m0/s1 |
| InChIKey | CSHSSTZOHARLNH-VIFPVBQESA-N |
| XLogP | 1.71 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.74 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |