C11H14ClF3N2O2 — CID 102715710
1-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-methoxypropan-2-ol (PubChem CID 102715710) has the molecular formula C11H14ClF3N2O2 and a molecular weight of 298.69 g/mol. Its IUPAC name is 1-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-methoxypropan-2-ol.
| Compound Name | 1-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 102715710 |
| Molecular Formula | C11H14ClF3N2O2 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)c1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C11H14ClF3N2O2/c1-17(5-8(18)6-19-2)10-4-7(11(13,14)15)3-9(12)16-10/h3-4,8,18H,5-6H2,1-2H3 |
| InChIKey | XOWDYUBNBFGIFT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|