C11H15ClN2O4 — CID 54998875
2-chloro-6-[(2-hydroxy-3-methoxypropyl)-methylamino]pyridine-4-carboxylic acid (PubChem CID 54998875) has the molecular formula C11H15ClN2O4 and a molecular weight of 274.70 g/mol. Its IUPAC name is 2-chloro-6-[(2-hydroxy-3-methoxypropyl)-methylamino]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[(2-hydroxy-3-methoxypropyl)-methylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 54998875 |
| Molecular Formula | C11H15ClN2O4 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-chloro-6-[(2-hydroxy-3-methoxypropyl)-methylamino]pyridine-4-carboxylic acid |
| SMILES | COCC(O)CN(C)c1cc(C(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C11H15ClN2O4/c1-14(5-8(15)6-18-2)10-4-7(11(16)17)3-9(12)13-10/h3-4,8,15H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | WUJHHSHTOLZDFH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|