C13H19ClN2O2 — CID 55000783
2-chloro-6-[2-methylpropyl(propan-2-yl)amino]pyridine-4-carboxylic acid (PubChem CID 55000783) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-chloro-6-[2-methylpropyl(propan-2-yl)amino]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[2-methylpropyl(propan-2-yl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 55000783 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-chloro-6-[2-methylpropyl(propan-2-yl)amino]pyridine-4-carboxylic acid |
| SMILES | CC(C)CN(c1cc(C(=O)O)cc(Cl)n1)C(C)C |
| InChI | InChI=1S/C13H19ClN2O2/c1-8(2)7-16(9(3)4)12-6-10(13(17)18)5-11(14)15-12/h5-6,8-9H,7H2,1-4H3,(H,17,18) |
| InChIKey | UFQFFSUMCWHSBH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|