C12H20ClN3O3 — CID 113400905
1-[[6-chloro-2-(ethoxymethyl)pyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol (PubChem CID 113400905) has the molecular formula C12H20ClN3O3 and a molecular weight of 289.76 g/mol. Its IUPAC name is 1-[[6-chloro-2-(ethoxymethyl)pyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol.
| Compound Name | 1-[[6-chloro-2-(ethoxymethyl)pyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 113400905 |
| Molecular Formula | C12H20ClN3O3 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-[[6-chloro-2-(ethoxymethyl)pyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol |
| SMILES | CCOCc1nc(Cl)cc(N(C)CC(O)COC)n1 |
| InChI | InChI=1S/C12H20ClN3O3/c1-4-19-8-11-14-10(13)5-12(15-11)16(2)6-9(17)7-18-3/h5,9,17H,4,6-8H2,1-3H3 |
| InChIKey | BLBBTXYRGUOESB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |