C14H26N4O2 — CID 80954748
1-[[6-(ethylamino)-2-propylpyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol (PubChem CID 80954748) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-[[6-(ethylamino)-2-propylpyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol.
| Compound Name | 1-[[6-(ethylamino)-2-propylpyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 80954748 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-[[6-(ethylamino)-2-propylpyrimidin-4-yl]-methylamino]-3-methoxypropan-2-ol |
| SMILES | CCCc1nc(NCC)cc(N(C)CC(O)COC)n1 |
| InChI | InChI=1S/C14H26N4O2/c1-5-7-12-16-13(15-6-2)8-14(17-12)18(3)9-11(19)10-20-4/h8,11,19H,5-7,9-10H2,1-4H3,(H,15,16,17) |
| InChIKey | IXRJBKXYGJCTIZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |