C12H20ClN3O3 — CID 114211195
2-[[6-chloro-2-(ethoxymethyl)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol (PubChem CID 114211195) has the molecular formula C12H20ClN3O3 and a molecular weight of 289.76 g/mol. Its IUPAC name is 2-[[6-chloro-2-(ethoxymethyl)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol.
| Compound Name | 2-[[6-chloro-2-(ethoxymethyl)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 114211195 |
| Molecular Formula | C12H20ClN3O3 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[[6-chloro-2-(ethoxymethyl)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol |
| SMILES | CCOCc1nc(Cl)cc(NC(CO)CCOC)n1 |
| InChI | InChI=1S/C12H20ClN3O3/c1-3-19-8-12-15-10(13)6-11(16-12)14-9(7-17)4-5-18-2/h6,9,17H,3-5,7-8H2,1-2H3,(H,14,15,16) |
| InChIKey | OVEXUWZQZYCFMH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |