C11H20N4O3 — CID 114157112
3-methoxy-2-[[2-(methoxymethyl)-6-(methylamino)pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 114157112) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-methoxy-2-[[2-(methoxymethyl)-6-(methylamino)pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-methoxy-2-[[2-(methoxymethyl)-6-(methylamino)pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 114157112 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 3-methoxy-2-[[2-(methoxymethyl)-6-(methylamino)pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | CNc1cc(NC(CO)COC)nc(COC)n1 |
| InChI | InChI=1S/C11H20N4O3/c1-12-9-4-10(13-8(5-16)6-17-2)15-11(14-9)7-18-3/h4,8,16H,5-7H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | GCRGBWDXVJBBNU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |