C11H20N4O3 — CID 106198708
2-[[6-amino-2-(ethoxymethyl)pyrimidin-4-yl]amino]-3-methoxypropan-1-ol (PubChem CID 106198708) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-[[6-amino-2-(ethoxymethyl)pyrimidin-4-yl]amino]-3-methoxypropan-1-ol.
| Compound Name | 2-[[6-amino-2-(ethoxymethyl)pyrimidin-4-yl]amino]-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 106198708 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-[[6-amino-2-(ethoxymethyl)pyrimidin-4-yl]amino]-3-methoxypropan-1-ol |
| SMILES | CCOCc1nc(N)cc(NC(CO)COC)n1 |
| InChI | InChI=1S/C11H20N4O3/c1-3-18-7-11-14-9(12)4-10(15-11)13-8(5-16)6-17-2/h4,8,16H,3,5-7H2,1-2H3,(H3,12,13,14,15) |
| InChIKey | DBQWRGYXVBRHSJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |