C8H13N3O2 — CID 82456558
6-methoxy-2-(methoxymethyl)-N-methylpyrimidin-4-amine (PubChem CID 82456558) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 6-methoxy-2-(methoxymethyl)-N-methylpyrimidin-4-amine.
| Compound Name | 6-methoxy-2-(methoxymethyl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 82456558 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 6-methoxy-2-(methoxymethyl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(OC)nc(COC)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-9-6-4-8(13-3)11-7(10-6)5-12-2/h4H,5H2,1-3H3,(H,9,10,11) |
| InChIKey | ZPFICKHCMULUPI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |